C20H32N6 — CID 146338851
1-tert-butyl-6-(7-tert-butyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridin-2-yl)-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridine (PubChem CID 146338851) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is 1-tert-butyl-6-(7-tert-butyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridin-2-yl)-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridine.
| Compound Name | 1-tert-butyl-6-(7-tert-butyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridin-2-yl)-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 146338851 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 1-tert-butyl-6-(7-tert-butyl-5,6-dihydro-4H-pyrazolo[3,4-b]pyridin-2-yl)-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridine |
| SMILES | CC(C)(C)N1CCCc2cn(C3CCc4cnn(C(C)(C)C)c4N3)nc21 |
| InChI | InChI=1S/C20H32N6/c1-19(2,3)24-11-7-8-15-13-25(23-18(15)24)16-10-9-14-12-21-26(17(14)22-16)20(4,5)6/h12-13,16,22H,7-11H2,1-6H3 |
| InChIKey | NASKLKSYRJAVGG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |