C8H13N3 — CID 146338854
2-ethyl-4,5,6,7-tetrahydropyrazolo[3,4-b]pyridine (PubChem CID 146338854) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-ethyl-4,5,6,7-tetrahydropyrazolo[3,4-b]pyridine.
| Compound Name | 2-ethyl-4,5,6,7-tetrahydropyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 146338854 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-ethyl-4,5,6,7-tetrahydropyrazolo[3,4-b]pyridine |
| SMILES | CCn1cc2c(n1)NCCC2 |
| InChI | InChI=1S/C8H13N3/c1-2-11-6-7-4-3-5-9-8(7)10-11/h6H,2-5H2,1H3,(H,9,10) |
| InChIKey | SVFFZHOLJINRGP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |