C15H18O4 — CID 146339328
4,7-dimethyl-3'-methylidenespiro[4,4a,5,8a-tetrahydro-3H-chromene-2,5'-oxolane]-2',8-dione (PubChem CID 146339328) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4,7-dimethyl-3'-methylidenespiro[4,4a,5,8a-tetrahydro-3H-chromene-2,5'-oxolane]-2',8-dione.
| Compound Name | 4,7-dimethyl-3'-methylidenespiro[4,4a,5,8a-tetrahydro-3H-chromene-2,5'-oxolane]-2',8-dione |
|---|---|
| PubChem CID | 146339328 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4,7-dimethyl-3'-methylidenespiro[4,4a,5,8a-tetrahydro-3H-chromene-2,5'-oxolane]-2',8-dione |
| SMILES | C=C1CC2(CC(C)C3CC=C(C)C(=O)C3O2)OC1=O |
| InChI | InChI=1S/C15H18O4/c1-8-4-5-11-9(2)6-15(18-13(11)12(8)16)7-10(3)14(17)19-15/h4,9,11,13H,3,5-7H2,1-2H3 |
| InChIKey | MRZTUNAGSUOOCU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|