C18H26N2 — CID 146339365
(2Z,4Z)-N-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(methylideneamino)-N-propan-2-ylhepta-2,4,6-trien-2-amine (PubChem CID 146339365) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (2Z,4Z)-N-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(methylideneamino)-N-propan-2-ylhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z)-N-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(methylideneamino)-N-propan-2-ylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 146339365 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (2Z,4Z)-N-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(methylideneamino)-N-propan-2-ylhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C\C(N=C)=C(/C)N(C/C(C=C)=C/C=C)C(C)C |
| InChI | InChI=1S/C18H26N2/c1-8-11-13-18(19-7)16(6)20(15(4)5)14-17(10-3)12-9-2/h8-13,15H,1-3,7,14H2,4-6H3/b13-11-,17-12+,18-16- |
| InChIKey | QXERSDLHSMUOJC-BMFVAXRNSA-N |
| XLogP | 4.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|