C15H31NO2 — CID 146339534
1-(2-ethyl-5-methoxy-2,4,4-trimethylpentyl)pyrrolidin-3-ol (PubChem CID 146339534) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-(2-ethyl-5-methoxy-2,4,4-trimethylpentyl)pyrrolidin-3-ol.
| Compound Name | 1-(2-ethyl-5-methoxy-2,4,4-trimethylpentyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 146339534 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 1-(2-ethyl-5-methoxy-2,4,4-trimethylpentyl)pyrrolidin-3-ol |
| SMILES | CCC(C)(CN1CCC(O)C1)CC(C)(C)COC |
| InChI | InChI=1S/C15H31NO2/c1-6-15(4,10-14(2,3)12-18-5)11-16-8-7-13(17)9-16/h13,17H,6-12H2,1-5H3 |
| InChIKey | UXIFPBCQESXNQM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |