About [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol
[4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol (PubChem CID 146339599) has the molecular formula C9H11N3OS
and a molecular weight of 209.27 g/mol. Its IUPAC name is [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol |
| PubChem CID | 146339599 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol |
| SMILES | CCNc1nccc2sc(CO)nc12 |
| InChI | InChI=1S/C9H11N3OS/c1-2-10-9-8-6(3-4-11-9)14-7(5-13)12-8/h3-4,13H,2,5H2,1H3,(H,10,11) |
| InChIKey | HFNBBAPVQIEGAB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol?
The IUPAC name of [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol (CID 146339599) is [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol.
What is the SMILES notation for [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol?
The canonical SMILES for [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol is CCNc1nccc2sc(CO)nc12.
What is the InChIKey of [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol?
The InChIKey is HFNBBAPVQIEGAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS/c1-2-10-9-8-6(3-4-11-9)14-7(5-13)12-8/h3-4,13H,2,5H2,1H3,(H,10,11).
What are the key properties of [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol?
[4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol has a molecular weight of 209.27 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(ethylamino)-[1,3]thiazolo[4,5-c]pyridin-2-yl]methanol is sourced from PubChem (CID 146339599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).