About 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole
4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole (PubChem CID 146340049) has the molecular formula C15H26ClNO5
and a molecular weight of 335.83 g/mol. Its IUPAC name is 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole |
| PubChem CID | 146340049 |
| Molecular Formula | C15H26ClNO5 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole |
| SMILES | CCOC(COc1noc(C(COC)C(C)C)c1Cl)OCC |
| InChI | InChI=1S/C15H26ClNO5/c1-6-19-12(20-7-2)9-21-15-13(16)14(22-17-15)11(8-18-5)10(3)4/h10-12H,6-9H2,1-5H3 |
| InChIKey | DEVAUHQIIZMEOZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole?
The IUPAC name of 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole (CID 146340049) is 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole.
What is the SMILES notation for 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole?
The canonical SMILES for 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole is CCOC(COc1noc(C(COC)C(C)C)c1Cl)OCC.
What is the InChIKey of 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole?
The InChIKey is DEVAUHQIIZMEOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26ClNO5/c1-6-19-12(20-7-2)9-21-15-13(16)14(22-17-15)11(8-18-5)10(3)4/h10-12H,6-9H2,1-5H3.
What are the key properties of 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole?
4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole has a molecular weight of 335.83 g/mol, XLogP of 3.49, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(2,2-diethoxyethoxy)-5-(1-methoxy-3-methylbutan-2-yl)-1,2-oxazole is sourced from PubChem (CID 146340049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).