C16H28N2 — CID 146340567
(3E,5Z)-N,3-dimethyl-N-(piperidin-4-ylmethyl)octa-3,5,7-trien-1-amine (PubChem CID 146340567) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (3E,5Z)-N,3-dimethyl-N-(piperidin-4-ylmethyl)octa-3,5,7-trien-1-amine.
| Compound Name | (3E,5Z)-N,3-dimethyl-N-(piperidin-4-ylmethyl)octa-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 146340567 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (3E,5Z)-N,3-dimethyl-N-(piperidin-4-ylmethyl)octa-3,5,7-trien-1-amine |
| SMILES | C=C/C=C\C=C(/C)CCN(C)CC1CCNCC1 |
| InChI | InChI=1S/C16H28N2/c1-4-5-6-7-15(2)10-13-18(3)14-16-8-11-17-12-9-16/h4-7,16-17H,1,8-14H2,2-3H3/b6-5-,15-7+ |
| InChIKey | WTDYOEJLMWNIGC-LPWWCAIVSA-N |
| XLogP | 3.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|