C24H31N3O5S — CID 146341265
N-[(3E)-5-[1-acetyl-4-(cyclobutanecarbonyl)-2-methyl-2,3-dihydroquinoxalin-6-yl]-2-methoxyhexa-1,3,5-trien-3-yl]methanesulfonamide (PubChem CID 146341265) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[(3E)-5-[1-acetyl-4-(cyclobutanecarbonyl)-2-methyl-2,3-dihydroquinoxalin-6-yl]-2-methoxyhexa-1,3,5-trien-3-yl]methanesulfonamide.
| Compound Name | N-[(3E)-5-[1-acetyl-4-(cyclobutanecarbonyl)-2-methyl-2,3-dihydroquinoxalin-6-yl]-2-methoxyhexa-1,3,5-trien-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 146341265 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[(3E)-5-[1-acetyl-4-(cyclobutanecarbonyl)-2-methyl-2,3-dihydroquinoxalin-6-yl]-2-methoxyhexa-1,3,5-trien-3-yl]methanesulfonamide |
| SMILES | C=C(OC)/C(=C\C(=C)c1ccc2c(c1)N(C(=O)C1CCC1)CC(C)N2C(C)=O)NS(C)(=O)=O |
| InChI | InChI=1S/C24H31N3O5S/c1-15(12-21(17(3)32-5)25-33(6,30)31)20-10-11-22-23(13-20)26(24(29)19-8-7-9-19)14-16(2)27(22)18(4)28/h10-13,16,19,25H,1,3,7-9,14H2,2,4-6H3/b21-12+ |
| InChIKey | GZIOZKGAABGQDN-CIAFOILYSA-N |
| XLogP | 3.18 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|