About 1-fluoro-2,4,5-trimethyl-3-propylbenzene
1-fluoro-2,4,5-trimethyl-3-propylbenzene (PubChem CID 146341300) has the molecular formula C12H17F
and a molecular weight of 180.27 g/mol. Its IUPAC name is 1-fluoro-2,4,5-trimethyl-3-propylbenzene.
Molecular Properties
| Compound Name | 1-fluoro-2,4,5-trimethyl-3-propylbenzene |
| PubChem CID | 146341300 |
| Molecular Formula | C12H17F |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-fluoro-2,4,5-trimethyl-3-propylbenzene |
| SMILES | CCCc1c(C)c(C)cc(F)c1C |
| InChI | InChI=1S/C12H17F/c1-5-6-11-9(3)8(2)7-12(13)10(11)4/h7H,5-6H2,1-4H3 |
| InChIKey | VYTLAJFHMBRBLT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-2,4,5-trimethyl-3-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2,4,5-trimethyl-3-propylbenzene?
The IUPAC name of 1-fluoro-2,4,5-trimethyl-3-propylbenzene (CID 146341300) is 1-fluoro-2,4,5-trimethyl-3-propylbenzene.
What is the SMILES notation for 1-fluoro-2,4,5-trimethyl-3-propylbenzene?
The canonical SMILES for 1-fluoro-2,4,5-trimethyl-3-propylbenzene is CCCc1c(C)c(C)cc(F)c1C.
What is the InChIKey of 1-fluoro-2,4,5-trimethyl-3-propylbenzene?
The InChIKey is VYTLAJFHMBRBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F/c1-5-6-11-9(3)8(2)7-12(13)10(11)4/h7H,5-6H2,1-4H3.
What are the key properties of 1-fluoro-2,4,5-trimethyl-3-propylbenzene?
1-fluoro-2,4,5-trimethyl-3-propylbenzene has a molecular weight of 180.27 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,4,5-trimethyl-3-propylbenzene is sourced from PubChem (CID 146341300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).