About [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate
[4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate (PubChem CID 146341320) has the molecular formula C15H11F2NS
and a molecular weight of 275.32 g/mol. Its IUPAC name is [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate.
Molecular Properties
| Compound Name | [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate |
| PubChem CID | 146341320 |
| Molecular Formula | C15H11F2NS |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate |
| SMILES | CCc1cccc(-c2cc(F)c(SC#N)c(F)c2)c1 |
| InChI | InChI=1S/C15H11F2NS/c1-2-10-4-3-5-11(6-10)12-7-13(16)15(19-9-18)14(17)8-12/h3-8H,2H2,1H3 |
| InChIKey | DEWJANYNBLQCAO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate?
The IUPAC name of [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate (CID 146341320) is [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate.
What is the SMILES notation for [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate?
The canonical SMILES for [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate is CCc1cccc(-c2cc(F)c(SC#N)c(F)c2)c1.
What is the InChIKey of [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate?
The InChIKey is DEWJANYNBLQCAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2NS/c1-2-10-4-3-5-11(6-10)12-7-13(16)15(19-9-18)14(17)8-12/h3-8H,2H2,1H3.
What are the key properties of [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate?
[4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate has a molecular weight of 275.32 g/mol, XLogP of 4.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-ethylphenyl)-2,6-difluorophenyl] thiocyanate is sourced from PubChem (CID 146341320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).