C15H25N — CID 146341446
(E)-4-ethyl-5,5,6-trimethyl-2-propa-1,2-dienylhept-3-en-1-imine (PubChem CID 146341446) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (E)-4-ethyl-5,5,6-trimethyl-2-propa-1,2-dienylhept-3-en-1-imine.
| Compound Name | (E)-4-ethyl-5,5,6-trimethyl-2-propa-1,2-dienylhept-3-en-1-imine |
|---|---|
| PubChem CID | 146341446 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (E)-4-ethyl-5,5,6-trimethyl-2-propa-1,2-dienylhept-3-en-1-imine |
| SMILES | [H]/N=C/C(C=C=C)/C=C(\CC)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H25N/c1-7-9-13(11-16)10-14(8-2)15(5,6)12(3)4/h9-13,16H,1,8H2,2-6H3/b14-10+,16-11+ |
| InChIKey | YFOXYVXKLDWHSI-LRHSVYTJSA-N |
| XLogP | 4.61 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|