About 3-iodo-1H-imidazol-2-one
3-iodo-1H-imidazol-2-one (PubChem CID 146341806) has the molecular formula C3H3IN2O
and a molecular weight of 209.97 g/mol. Its IUPAC name is 3-iodo-1H-imidazol-2-one.
Molecular Properties
| Compound Name | 3-iodo-1H-imidazol-2-one |
| PubChem CID | 146341806 |
| Molecular Formula | C3H3IN2O |
| Molecular Weight | 209.97 g/mol |
| Exact Mass | 209.93 |
| IUPAC Name | 3-iodo-1H-imidazol-2-one |
| SMILES | O=c1[nH]ccn1I |
| InChI | InChI=1S/C3H3IN2O/c4-6-2-1-5-3(6)7/h1-2H,(H,5,7) |
| InChIKey | MXOIIPKDZURXII-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.97 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-1H-imidazol-2-one?
The IUPAC name of 3-iodo-1H-imidazol-2-one (CID 146341806) is 3-iodo-1H-imidazol-2-one.
What is the SMILES notation for 3-iodo-1H-imidazol-2-one?
The canonical SMILES for 3-iodo-1H-imidazol-2-one is O=c1[nH]ccn1I.
What is the InChIKey of 3-iodo-1H-imidazol-2-one?
The InChIKey is MXOIIPKDZURXII-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3IN2O/c4-6-2-1-5-3(6)7/h1-2H,(H,5,7).
What are the key properties of 3-iodo-1H-imidazol-2-one?
3-iodo-1H-imidazol-2-one has a molecular weight of 209.97 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-1H-imidazol-2-one is sourced from PubChem (CID 146341806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).