C13H27F2NO — CID 146342441
N-(3,3-difluoropropyl)-5-methoxy-2,2,4,4-tetramethylpentan-1-amine (PubChem CID 146342441) has the molecular formula C13H27F2NO and a molecular weight of 251.36 g/mol. Its IUPAC name is N-(3,3-difluoropropyl)-5-methoxy-2,2,4,4-tetramethylpentan-1-amine.
| Compound Name | N-(3,3-difluoropropyl)-5-methoxy-2,2,4,4-tetramethylpentan-1-amine |
|---|---|
| PubChem CID | 146342441 |
| Molecular Formula | C13H27F2NO |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | N-(3,3-difluoropropyl)-5-methoxy-2,2,4,4-tetramethylpentan-1-amine |
| SMILES | COCC(C)(C)CC(C)(C)CNCCC(F)F |
| InChI | InChI=1S/C13H27F2NO/c1-12(2,8-13(3,4)10-17-5)9-16-7-6-11(14)15/h11,16H,6-10H2,1-5H3 |
| InChIKey | IEBRSZASZOCECM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|