C23H22BrN3O — CID 146342465
2-[[7-bromo-2-(2-methyl-3-phenylphenyl)indazol-5-yl]methylamino]ethanol (PubChem CID 146342465) has the molecular formula C23H22BrN3O and a molecular weight of 436.35 g/mol. Its IUPAC name is 2-[[7-bromo-2-(2-methyl-3-phenylphenyl)indazol-5-yl]methylamino]ethanol.
| Compound Name | 2-[[7-bromo-2-(2-methyl-3-phenylphenyl)indazol-5-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 146342465 |
| Molecular Formula | C23H22BrN3O |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-[[7-bromo-2-(2-methyl-3-phenylphenyl)indazol-5-yl]methylamino]ethanol |
| SMILES | Cc1c(-c2ccccc2)cccc1-n1cc2cc(CNCCO)cc(Br)c2n1 |
| InChI | InChI=1S/C23H22BrN3O/c1-16-20(18-6-3-2-4-7-18)8-5-9-22(16)27-15-19-12-17(14-25-10-11-28)13-21(24)23(19)26-27/h2-9,12-13,15,25,28H,10-11,14H2,1H3 |
| InChIKey | ZDDAAGSVAIKSIZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|