C9H15NO2S — CID 146342704
(2E,4Z)-N-ethylhepta-2,4,6-triene-3-sulfonamide (PubChem CID 146342704) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is (2E,4Z)-N-ethylhepta-2,4,6-triene-3-sulfonamide.
| Compound Name | (2E,4Z)-N-ethylhepta-2,4,6-triene-3-sulfonamide |
|---|---|
| PubChem CID | 146342704 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (2E,4Z)-N-ethylhepta-2,4,6-triene-3-sulfonamide |
| SMILES | C=C/C=C\C(=C/C)S(=O)(=O)NCC |
| InChI | InChI=1S/C9H15NO2S/c1-4-7-8-9(5-2)13(11,12)10-6-3/h4-5,7-8,10H,1,6H2,2-3H3/b8-7-,9-5+ |
| InChIKey | ODKNJKBZTWTUIO-ISXYNVPDSA-N |
| XLogP | 1.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|