About ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate
ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate (PubChem CID 146342720) has the molecular formula C14H22O2S
and a molecular weight of 254.39 g/mol. Its IUPAC name is ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate |
| PubChem CID | 146342720 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)c1ccc(S(C)(C)C)cc1 |
| InChI | InChI=1S/C14H22O2S/c1-6-16-14(15)11(2)12-7-9-13(10-8-12)17(3,4)5/h7-11H,6H2,1-5H3/t11-/m0/s1 |
| InChIKey | SENSUXZRCPUWMD-NSHDSACASA-N |
| XLogP | 3.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate?
The IUPAC name of ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate (CID 146342720) is ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate.
What is the SMILES notation for ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate?
The canonical SMILES for ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate is CCOC(=O)[C@@H](C)c1ccc(S(C)(C)C)cc1.
What is the InChIKey of ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate?
The InChIKey is SENSUXZRCPUWMD-NSHDSACASA-N. The full InChI is InChI=1S/C14H22O2S/c1-6-16-14(15)11(2)12-7-9-13(10-8-12)17(3,4)5/h7-11H,6H2,1-5H3/t11-/m0/s1.
What are the key properties of ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate?
ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate has a molecular weight of 254.39 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-[4-(trimethyl-λ4-sulfanyl)phenyl]propanoate is sourced from PubChem (CID 146342720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).