(E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid

C8H9NO2 — CID 146343289

IUPAC(E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid
SMILESO=C(O)/C=C/C1C=CN=CC1
InChIInChI=1S/C8H9NO2/c10-8(11)2-1-7-3-5-9-6-4-7/h1-3,5-7H,4H2,(H,10,11)/b2-1+
InChIKeyQFMBXUBJKABUTH-OWOJBTEDSA-N
MW151.16 g/mol
LogP1.23
Rot. Bonds2

About (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid

(E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid (PubChem CID 146343289) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid
PubChem CID146343289
Molecular FormulaC8H9NO2
Molecular Weight151.16 g/mol
Exact Mass151.06
IUPAC Name(E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid
SMILESO=C(O)/C=C/C1C=CN=CC1
InChIInChI=1S/C8H9NO2/c10-8(11)2-1-7-3-5-9-6-4-7/h1-3,5-7H,4H2,(H,10,11)/b2-1+
InChIKeyQFMBXUBJKABUTH-OWOJBTEDSA-N
XLogP1.23
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.16
LogP ≤ 51.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid?
The IUPAC name of (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid (CID 146343289) is (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid is O=C(O)/C=C/C1C=CN=CC1.
What is the InChIKey of (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid?
The InChIKey is QFMBXUBJKABUTH-OWOJBTEDSA-N. The full InChI is InChI=1S/C8H9NO2/c10-8(11)2-1-7-3-5-9-6-4-7/h1-3,5-7H,4H2,(H,10,11)/b2-1+.
What are the key properties of (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid?
(E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid has a molecular weight of 151.16 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,4-dihydropyridin-4-yl)prop-2-enoic acid is sourced from PubChem (CID 146343289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).