C25H28N4O4 — CID 146343301
[(6aR)-6-methyl-11-(2-methylpropanoyloxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] 4-azidobutanoate (PubChem CID 146343301) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is [(6aR)-6-methyl-11-(2-methylpropanoyloxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] 4-azidobutanoate.
| Compound Name | [(6aR)-6-methyl-11-(2-methylpropanoyloxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] 4-azidobutanoate |
|---|---|
| PubChem CID | 146343301 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(6aR)-6-methyl-11-(2-methylpropanoyloxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-10-yl] 4-azidobutanoate |
| SMILES | CC(C)C(=O)Oc1c(OC(=O)CCCN=[N+]=[N-])ccc2c1-c1cccc3c1[C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C25H28N4O4/c1-15(2)25(31)33-24-20(32-21(30)8-5-12-27-28-26)10-9-17-14-19-22-16(11-13-29(19)3)6-4-7-18(22)23(17)24/h4,6-7,9-10,15,19H,5,8,11-14H2,1-3H3/t19-/m1/s1 |
| InChIKey | LVKBBEXNTDXVBA-LJQANCHMSA-N |
| XLogP | 5.00 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|