C20H24N6OS — CID 146343521
5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1,6,7,8-tetrahydroimidazo[4,5-c]azepin-4-one (PubChem CID 146343521) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1,6,7,8-tetrahydroimidazo[4,5-c]azepin-4-one.
| Compound Name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1,6,7,8-tetrahydroimidazo[4,5-c]azepin-4-one |
|---|---|
| PubChem CID | 146343521 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-1,6,7,8-tetrahydroimidazo[4,5-c]azepin-4-one |
| SMILES | O=C1c2nc[nH]c2CCCN1CCN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C20H24N6OS/c27-20-18-16(21-14-22-18)5-3-7-26(20)13-10-24-8-11-25(12-9-24)19-15-4-1-2-6-17(15)28-23-19/h1-2,4,6,14H,3,5,7-13H2,(H,21,22) |
| InChIKey | CXLVVCJMIHLIFY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |