About 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one
6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one (PubChem CID 146343528) has the molecular formula C21H22N6O2
and a molecular weight of 390.45 g/mol. Its IUPAC name is 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one |
| PubChem CID | 146343528 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one |
| SMILES | Cc1ncc2c(=O)n(CCN3CCN(c4noc5ccccc45)CC3)ccc2n1 |
| InChI | InChI=1S/C21H22N6O2/c1-15-22-14-17-18(23-15)6-7-27(21(17)28)13-10-25-8-11-26(12-9-25)20-16-4-2-3-5-19(16)29-24-20/h2-7,14H,8-13H2,1H3 |
| InChIKey | PHAVNSHDZRSZRT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one?
The IUPAC name of 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one (CID 146343528) is 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one?
The canonical SMILES for 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one is Cc1ncc2c(=O)n(CCN3CCN(c4noc5ccccc45)CC3)ccc2n1.
What is the InChIKey of 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one?
The InChIKey is PHAVNSHDZRSZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N6O2/c1-15-22-14-17-18(23-15)6-7-27(21(17)28)13-10-25-8-11-26(12-9-25)20-16-4-2-3-5-19(16)29-24-20/h2-7,14H,8-13H2,1H3.
What are the key properties of 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one?
6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one has a molecular weight of 390.45 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]-2-methylpyrido[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 146343528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).