C22H23FN4O2 — CID 146343620
7-[2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-fluoro-5,6-dihydro-1,7-naphthyridin-8-one (PubChem CID 146343620) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 7-[2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-fluoro-5,6-dihydro-1,7-naphthyridin-8-one.
| Compound Name | 7-[2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-fluoro-5,6-dihydro-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 146343620 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 7-[2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-fluoro-5,6-dihydro-1,7-naphthyridin-8-one |
| SMILES | O=C1c2nc(F)ccc2CCN1CCN1CCC(c2noc3ccccc23)CC1 |
| InChI | InChI=1S/C22H23FN4O2/c23-19-6-5-15-9-12-27(22(28)21(15)24-19)14-13-26-10-7-16(8-11-26)20-17-3-1-2-4-18(17)29-25-20/h1-6,16H,7-14H2 |
| InChIKey | NKTWRBGCUILKQQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|