C17H19F2N5O — CID 146343767
1-[(3R)-3-[[5-(2,2-difluorocyclopropyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 146343767) has the molecular formula C17H19F2N5O and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-[(3R)-3-[[5-(2,2-difluorocyclopropyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[[5-(2,2-difluorocyclopropyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146343767 |
| Molecular Formula | C17H19F2N5O |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-[(3R)-3-[[5-(2,2-difluorocyclopropyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](Nc2ncnc3[nH]cc(C4CC4(F)F)c23)C1 |
| InChI | InChI=1S/C17H19F2N5O/c1-2-13(25)24-5-3-4-10(8-24)23-16-14-11(12-6-17(12,18)19)7-20-15(14)21-9-22-16/h2,7,9-10,12H,1,3-6,8H2,(H2,20,21,22,23)/t10-,12?/m1/s1 |
| InChIKey | QHXVBRSKUQYKQQ-RWANSRKNSA-N |
| XLogP | 2.67 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|