C20H25F2N5O — CID 146343874
1-[(2S,5R)-5-[[5-[(1R)-2,2-difluoro-3,3-dimethylcyclopropyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 146343874) has the molecular formula C20H25F2N5O and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-[(2S,5R)-5-[[5-[(1R)-2,2-difluoro-3,3-dimethylcyclopropyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,5R)-5-[[5-[(1R)-2,2-difluoro-3,3-dimethylcyclopropyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146343874 |
| Molecular Formula | C20H25F2N5O |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-[(2S,5R)-5-[[5-[(1R)-2,2-difluoro-3,3-dimethylcyclopropyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](Nc2ncnc3[nH]cc([C@@H]4C(C)(C)C4(F)F)c23)CC[C@@H]1C |
| InChI | InChI=1S/C20H25F2N5O/c1-5-14(28)27-9-12(7-6-11(27)2)26-18-15-13(8-23-17(15)24-10-25-18)16-19(3,4)20(16,21)22/h5,8,10-12,16H,1,6-7,9H2,2-4H3,(H2,23,24,25,26)/t11-,12+,16+/m0/s1 |
| InChIKey | HKLDOPMCCOCUEV-HWWQOWPSSA-N |
| XLogP | 3.69 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|