C19H23F2N5O — CID 146343892
1-[(2S,5R)-5-[[5-[(1S,3S)-2,2-difluoro-3-methylcyclopropyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 146343892) has the molecular formula C19H23F2N5O and a molecular weight of 375.42 g/mol. Its IUPAC name is 1-[(2S,5R)-5-[[5-[(1S,3S)-2,2-difluoro-3-methylcyclopropyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,5R)-5-[[5-[(1S,3S)-2,2-difluoro-3-methylcyclopropyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146343892 |
| Molecular Formula | C19H23F2N5O |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-[(2S,5R)-5-[[5-[(1S,3S)-2,2-difluoro-3-methylcyclopropyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](Nc2ncnc3[nH]cc([C@@H]4[C@H](C)C4(F)F)c23)CC[C@@H]1C |
| InChI | InChI=1S/C19H23F2N5O/c1-4-14(27)26-8-12(6-5-10(26)2)25-18-15-13(16-11(3)19(16,20)21)7-22-17(15)23-9-24-18/h4,7,9-12,16H,1,5-6,8H2,2-3H3,(H2,22,23,24,25)/t10-,11-,12+,16-/m0/s1 |
| InChIKey | AMLXEUSZAUZKOB-OVZMXSCWSA-N |
| XLogP | 3.30 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|