C22H27F2N5O — CID 146343918
1-[(2S,5R)-5-[[5-[(3R,6S)-2,2-difluorospiro[2.4]heptan-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 146343918) has the molecular formula C22H27F2N5O and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-[(2S,5R)-5-[[5-[(3R,6S)-2,2-difluorospiro[2.4]heptan-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S,5R)-5-[[5-[(3R,6S)-2,2-difluorospiro[2.4]heptan-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146343918 |
| Molecular Formula | C22H27F2N5O |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-[(2S,5R)-5-[[5-[(3R,6S)-2,2-difluorospiro[2.4]heptan-6-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-2-methylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](Nc2ncnc3[nH]cc([C@H]4CC[C@@]5(C4)CC5(F)F)c23)CC[C@@H]1C |
| InChI | InChI=1S/C22H27F2N5O/c1-3-17(30)29-10-15(5-4-13(29)2)28-20-18-16(9-25-19(18)26-12-27-20)14-6-7-21(8-14)11-22(21,23)24/h3,9,12-15H,1,4-8,10-11H2,2H3,(H2,25,26,27,28)/t13-,14-,15+,21+/m0/s1 |
| InChIKey | UVMRUUAXXSEKBU-FQSKDFRHSA-N |
| XLogP | 4.23 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|