C37H39F3O7S3 — CID 146344452
[5-ethoxysulfonyl-4,5,5-trifluoro-2-[4-(4-phenylsulfanylbenzoyl)phenyl]sulfanylpentan-2-yl] 3-hydroxyadamantane-1-carboxylate (PubChem CID 146344452) has the molecular formula C37H39F3O7S3 and a molecular weight of 748.91 g/mol. Its IUPAC name is [5-ethoxysulfonyl-4,5,5-trifluoro-2-[4-(4-phenylsulfanylbenzoyl)phenyl]sulfanylpentan-2-yl] 3-hydroxyadamantane-1-carboxylate.
| Compound Name | [5-ethoxysulfonyl-4,5,5-trifluoro-2-[4-(4-phenylsulfanylbenzoyl)phenyl]sulfanylpentan-2-yl] 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 146344452 |
| Molecular Formula | C37H39F3O7S3 |
| Molecular Weight | 748.91 g/mol |
| Exact Mass | 748.18 |
| IUPAC Name | [5-ethoxysulfonyl-4,5,5-trifluoro-2-[4-(4-phenylsulfanylbenzoyl)phenyl]sulfanylpentan-2-yl] 3-hydroxyadamantane-1-carboxylate |
| SMILES | CCOS(=O)(=O)C(F)(F)C(F)CC(C)(OC(=O)C12CC3CC(CC(O)(C3)C1)C2)Sc1ccc(C(=O)c2ccc(Sc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H39F3O7S3/c1-3-46-50(44,45)37(39,40)31(38)22-34(2,47-33(42)35-18-24-17-25(19-35)21-36(43,20-24)23-35)49-30-15-11-27(12-16-30)32(41)26-9-13-29(14-10-26)48-28-7-5-4-6-8-28/h4-16,24-25,31,43H,3,17-23H2,1-2H3 |
| InChIKey | FLILIEMYLOFPFG-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.91 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|