About 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one
2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 146344638) has the molecular formula C8H8F3N3O
and a molecular weight of 219.17 g/mol. Its IUPAC name is 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one.
Molecular Properties
| Compound Name | 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one |
| PubChem CID | 146344638 |
| Molecular Formula | C8H8F3N3O |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | Cn1nc2c(c1C(F)(F)F)C(=O)NCC2 |
| InChI | InChI=1S/C8H8F3N3O/c1-14-6(8(9,10)11)5-4(13-14)2-3-12-7(5)15/h2-3H2,1H3,(H,12,15) |
| InChIKey | WSWGNXZJFWGUCK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one?
The IUPAC name of 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one (CID 146344638) is 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one.
What is the SMILES notation for 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one?
The canonical SMILES for 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one is Cn1nc2c(c1C(F)(F)F)C(=O)NCC2.
What is the InChIKey of 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one?
The InChIKey is WSWGNXZJFWGUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3O/c1-14-6(8(9,10)11)5-4(13-14)2-3-12-7(5)15/h2-3H2,1H3,(H,12,15).
What are the key properties of 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one?
2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one has a molecular weight of 219.17 g/mol, XLogP of 0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(trifluoromethyl)-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one is sourced from PubChem (CID 146344638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).