4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid

C36H20O16 — CID 146344853

IUPAC4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid
SMILESO=C(O)c1ccc(C#Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O.O=C(O)c1ccc(C#Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O
InChIInChI=1S/2C18H10O8/c2*19-15(20)11-5-3-9(7-13(11)17(23)24)1-2-10-4-6-12(16(21)22)14(8-10)18(25)26/h2*3-8H,(H,19,20)(H,21,22)(H,23,24)(H,25,26)
InChIKeySQBWQXIHXDLVQK-UHFFFAOYSA-N
MW708.54 g/mol
LogP3.76
Rot. Bonds8

About 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid

4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid (PubChem CID 146344853) has the molecular formula C36H20O16 and a molecular weight of 708.54 g/mol. Its IUPAC name is 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid.

Molecular Properties

Compound Name4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid
PubChem CID146344853
Molecular FormulaC36H20O16
Molecular Weight708.54 g/mol
Exact Mass708.08
IUPAC Name4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid
SMILESO=C(O)c1ccc(C#Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O.O=C(O)c1ccc(C#Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O
InChIInChI=1S/2C18H10O8/c2*19-15(20)11-5-3-9(7-13(11)17(23)24)1-2-10-4-6-12(16(21)22)14(8-10)18(25)26/h2*3-8H,(H,19,20)(H,21,22)(H,23,24)(H,25,26)
InChIKeySQBWQXIHXDLVQK-UHFFFAOYSA-N
XLogP3.76
TPSA298.40 Ų
H-Bond Donors8
H-Bond Acceptors8
Rotatable Bonds8
Heavy Atoms52
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500708.54
LogP ≤ 53.76
H-Bond Donors ≤ 58
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid?
The IUPAC name of 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid (CID 146344853) is 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid.
What is the SMILES notation for 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid?
The canonical SMILES for 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid is O=C(O)c1ccc(C#Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O.O=C(O)c1ccc(C#Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O.
What is the InChIKey of 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid?
The InChIKey is SQBWQXIHXDLVQK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H10O8/c2*19-15(20)11-5-3-9(7-13(11)17(23)24)1-2-10-4-6-12(16(21)22)14(8-10)18(25)26/h2*3-8H,(H,19,20)(H,21,22)(H,23,24)(H,25,26).
What are the key properties of 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid?
4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid has a molecular weight of 708.54 g/mol, XLogP of 3.76, 8 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid is sourced from PubChem (CID 146344853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).