C36H20O16 — CID 146344853
4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid (PubChem CID 146344853) has the molecular formula C36H20O16 and a molecular weight of 708.54 g/mol. Its IUPAC name is 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid.
| Compound Name | 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid |
|---|---|
| PubChem CID | 146344853 |
| Molecular Formula | C36H20O16 |
| Molecular Weight | 708.54 g/mol |
| Exact Mass | 708.08 |
| IUPAC Name | 4-[2-(3,4-dicarboxyphenyl)ethynyl]phthalic acid |
| SMILES | O=C(O)c1ccc(C#Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O.O=C(O)c1ccc(C#Cc2ccc(C(=O)O)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/2C18H10O8/c2*19-15(20)11-5-3-9(7-13(11)17(23)24)1-2-10-4-6-12(16(21)22)14(8-10)18(25)26/h2*3-8H,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | SQBWQXIHXDLVQK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|