About 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate
3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 146345088) has the molecular formula C8H9F3N2O4S
and a molecular weight of 286.23 g/mol. Its IUPAC name is 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate.
Molecular Properties
| Compound Name | 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate |
| PubChem CID | 146345088 |
| Molecular Formula | C8H9F3N2O4S |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | O=C(n1cc[n+](CCCS(=O)(=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O4S/c9-8(10,11)7(14)13-4-3-12(6-13)2-1-5-18(15,16)17/h3-4,6H,1-2,5H2 |
| InChIKey | VPKBMYGGAANWFX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate?
The IUPAC name of 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate (CID 146345088) is 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate.
What is the SMILES notation for 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate?
The canonical SMILES for 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate is O=C(n1cc[n+](CCCS(=O)(=O)[O-])c1)C(F)(F)F.
What is the InChIKey of 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate?
The InChIKey is VPKBMYGGAANWFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O4S/c9-8(10,11)7(14)13-4-3-12(6-13)2-1-5-18(15,16)17/h3-4,6H,1-2,5H2.
What are the key properties of 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate?
3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate has a molecular weight of 286.23 g/mol, XLogP of -0.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,2,2-trifluoroacetyl)imidazol-1-ium-1-yl]propane-1-sulfonate is sourced from PubChem (CID 146345088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).