C19H30FN3 — CID 146345901
(1Z,3E,4Z)-3-(aminomethylidene)-2-[(Z)-but-1-enyl]-4-(2-fluoro-3-methylbut-2-enylidene)-1-N,5-N,5-N-trimethylhexa-1,5-diene-1,5-diamine (PubChem CID 146345901) has the molecular formula C19H30FN3 and a molecular weight of 319.47 g/mol. Its IUPAC name is (1Z,3E,4Z)-3-(aminomethylidene)-2-[(Z)-but-1-enyl]-4-(2-fluoro-3-methylbut-2-enylidene)-1-N,5-N,5-N-trimethylhexa-1,5-diene-1,5-diamine.
| Compound Name | (1Z,3E,4Z)-3-(aminomethylidene)-2-[(Z)-but-1-enyl]-4-(2-fluoro-3-methylbut-2-enylidene)-1-N,5-N,5-N-trimethylhexa-1,5-diene-1,5-diamine |
|---|---|
| PubChem CID | 146345901 |
| Molecular Formula | C19H30FN3 |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | (1Z,3E,4Z)-3-(aminomethylidene)-2-[(Z)-but-1-enyl]-4-(2-fluoro-3-methylbut-2-enylidene)-1-N,5-N,5-N-trimethylhexa-1,5-diene-1,5-diamine |
| SMILES | C=C(/C(=C\C(F)=C(C)C)C(=CN)C(/C=C\CC)=C\NC)N(C)C |
| InChI | InChI=1S/C19H30FN3/c1-8-9-10-16(13-22-5)18(12-21)17(15(4)23(6)7)11-19(20)14(2)3/h9-13,22H,4,8,21H2,1-3,5-7H3/b10-9-,16-13-,17-11+,18-12+ |
| InChIKey | WOMUXVAXHMNYJH-JYISUHQMSA-N |
| XLogP | 4.16 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|