C24H25N5O3 — CID 146346262
(2R,3R,3aS,6S,6aR)-6-[(2-aminoquinolin-7-yl)methyl]-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol (PubChem CID 146346262) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is (2R,3R,3aS,6S,6aR)-6-[(2-aminoquinolin-7-yl)methyl]-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol.
| Compound Name | (2R,3R,3aS,6S,6aR)-6-[(2-aminoquinolin-7-yl)methyl]-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol |
|---|---|
| PubChem CID | 146346262 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (2R,3R,3aS,6S,6aR)-6-[(2-aminoquinolin-7-yl)methyl]-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,3a-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@@H]2[C@H](Cc3ccc4ccc(N)nc4c3)CC[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C24H25N5O3/c1-13-17-7-9-29(22(17)27-12-26-13)23-20(30)24(31)8-6-16(21(24)32-23)10-14-2-3-15-4-5-19(25)28-18(15)11-14/h2-5,7,9,11-12,16,20-21,23,30-31H,6,8,10H2,1H3,(H2,25,28)/t16-,20-,21+,23+,24-/m0/s1 |
| InChIKey | FVZMRHOWIQXBFP-RLZGZKAYSA-N |
| XLogP | 2.51 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |