C11H16O5 — CID 146346313
(1S,5R,8S)-6-methoxy-3,3-dimethyl-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-one (PubChem CID 146346313) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (1S,5R,8S)-6-methoxy-3,3-dimethyl-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-one.
| Compound Name | (1S,5R,8S)-6-methoxy-3,3-dimethyl-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-one |
|---|---|
| PubChem CID | 146346313 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (1S,5R,8S)-6-methoxy-3,3-dimethyl-2,4,7-trioxatricyclo[6.3.0.01,5]undecan-9-one |
| SMILES | COC1O[C@@H]2C(=O)CC[C@@]23OC(C)(C)O[C@@H]13 |
| InChI | InChI=1S/C11H16O5/c1-10(2)15-8-9(13-3)14-7-6(12)4-5-11(7,8)16-10/h7-9H,4-5H2,1-3H3/t7-,8+,9?,11-/m1/s1 |
| InChIKey | AAFJDNODSZATMQ-GQEBFOJWSA-N |
| XLogP | 0.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |