C24H24F2N2O4 — CID 146346324
(3R,3aS,5S,6S)-6-[(2-amino-3-fluoroquinolin-7-yl)methyl]-5-fluoro-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3-diol (PubChem CID 146346324) has the molecular formula C24H24F2N2O4 and a molecular weight of 442.46 g/mol. Its IUPAC name is (3R,3aS,5S,6S)-6-[(2-amino-3-fluoroquinolin-7-yl)methyl]-5-fluoro-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3-diol.
| Compound Name | (3R,3aS,5S,6S)-6-[(2-amino-3-fluoroquinolin-7-yl)methyl]-5-fluoro-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3-diol |
|---|---|
| PubChem CID | 146346324 |
| Molecular Formula | C24H24F2N2O4 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (3R,3aS,5S,6S)-6-[(2-amino-3-fluoroquinolin-7-yl)methyl]-5-fluoro-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3-diol |
| SMILES | Nc1nc2cc(C[C@H]3C4OC(O)[C@H](O)[C@@]4(OCc4ccccc4)C[C@@H]3F)ccc2cc1F |
| InChI | InChI=1S/C24H24F2N2O4/c25-17-10-15-7-6-14(9-19(15)28-22(17)27)8-16-18(26)11-24(20(29)23(30)32-21(16)24)31-12-13-4-2-1-3-5-13/h1-7,9-10,16,18,20-21,23,29-30H,8,11-12H2,(H2,27,28)/t16-,18+,20+,21?,23?,24+/m1/s1 |
| InChIKey | ZKYUJTGJCIJUIK-IKSCCAAZSA-N |
| XLogP | 2.89 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |