About (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one
(2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 146346774) has the molecular formula C6H9FN2O2
and a molecular weight of 160.15 g/mol. Its IUPAC name is (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one.
Molecular Properties
| Compound Name | (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| PubChem CID | 146346774 |
| Molecular Formula | C6H9FN2O2 |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N(O)[C@@H]2CC[C@@H](F)N1C2 |
| InChI | InChI=1S/C6H9FN2O2/c7-5-2-1-4-3-8(5)6(10)9(4)11/h4-5,11H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | VUDKCDXFXRKNAG-UHNVWZDZSA-N |
| XLogP | 0.57 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one?
The IUPAC name of (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one (CID 146346774) is (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one.
What is the SMILES notation for (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one?
The canonical SMILES for (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one is O=C1N(O)[C@@H]2CC[C@@H](F)N1C2.
What is the InChIKey of (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one?
The InChIKey is VUDKCDXFXRKNAG-UHNVWZDZSA-N. The full InChI is InChI=1S/C6H9FN2O2/c7-5-2-1-4-3-8(5)6(10)9(4)11/h4-5,11H,1-3H2/t4-,5+/m1/s1.
What are the key properties of (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one?
(2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one has a molecular weight of 160.15 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one is sourced from PubChem (CID 146346774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).