C27H30FN5O6 — CID 146347056
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate (PubChem CID 146347056) has the molecular formula C27H30FN5O6 and a molecular weight of 539.56 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 146347056 |
| Molecular Formula | C27H30FN5O6 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl] 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)CC(C)(C)c1c(C)cc(C)cc1OC(C)=O |
| InChI | InChI=1S/C27H30FN5O6/c1-7-27(12-34)18(10-19(39-27)33-13-30-22-23(29)31-25(28)32-24(22)33)38-20(36)11-26(5,6)21-15(3)8-14(2)9-17(21)37-16(4)35/h1,8-9,13,18-19,34H,10-12H2,2-6H3,(H2,29,31,32)/t18-,19+,27+/m0/s1 |
| InChIKey | RUZHYLAQZZEELC-DSNGTPCMSA-N |
| XLogP | 2.65 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|