C26H28ClN3O5 — CID 146347131
1-[5,5-bis(4-methoxyphenyl)pentyl]-3-(4-chloro-3-nitrophenyl)urea (PubChem CID 146347131) has the molecular formula C26H28ClN3O5 and a molecular weight of 497.98 g/mol. Its IUPAC name is 1-[5,5-bis(4-methoxyphenyl)pentyl]-3-(4-chloro-3-nitrophenyl)urea.
| Compound Name | 1-[5,5-bis(4-methoxyphenyl)pentyl]-3-(4-chloro-3-nitrophenyl)urea |
|---|---|
| PubChem CID | 146347131 |
| Molecular Formula | C26H28ClN3O5 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 1-[5,5-bis(4-methoxyphenyl)pentyl]-3-(4-chloro-3-nitrophenyl)urea |
| SMILES | COc1ccc(C(CCCCNC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H28ClN3O5/c1-34-21-11-6-18(7-12-21)23(19-8-13-22(35-2)14-9-19)5-3-4-16-28-26(31)29-20-10-15-24(27)25(17-20)30(32)33/h6-15,17,23H,3-5,16H2,1-2H3,(H2,28,29,31) |
| InChIKey | QMPRVWKYCBWFIV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|