C19H16ClF4N3O4 — CID 146347145
(2R,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-[[3-(difluoromethyl)-2,5-difluorophenyl]-hydroxymethyl]-3-methyloxolane-3,4-diol (PubChem CID 146347145) has the molecular formula C19H16ClF4N3O4 and a molecular weight of 461.80 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-[[3-(difluoromethyl)-2,5-difluorophenyl]-hydroxymethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-[[3-(difluoromethyl)-2,5-difluorophenyl]-hydroxymethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 146347145 |
| Molecular Formula | C19H16ClF4N3O4 |
| Molecular Weight | 461.80 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | (2R,3S,4R,5R)-5-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2-[[3-(difluoromethyl)-2,5-difluorophenyl]-hydroxymethyl]-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@@H](C(O)c2cc(F)cc(C(F)F)c2F)O[C@@H](n2ccc3c(Cl)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C19H16ClF4N3O4/c1-19(30)13(29)18(27-3-2-8-15(20)25-6-26-17(8)27)31-14(19)12(28)9-4-7(21)5-10(11(9)22)16(23)24/h2-6,12-14,16,18,28-30H,1H3/t12?,13-,14+,18+,19-/m0/s1 |
| InChIKey | KQTGIDQYCHMJHA-NJYJKMNUSA-N |
| XLogP | 3.04 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.80 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |