C26H30O4 — CID 146347379
5-[(E)-3,5-diphenyl-2-propan-2-ylpent-4-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 146347379) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is 5-[(E)-3,5-diphenyl-2-propan-2-ylpent-4-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(E)-3,5-diphenyl-2-propan-2-ylpent-4-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 146347379 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 5-[(E)-3,5-diphenyl-2-propan-2-ylpent-4-enyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC(C)C(CC1C(=O)OC(C)(C)OC1=O)C(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30O4/c1-18(2)22(17-23-24(27)29-26(3,4)30-25(23)28)21(20-13-9-6-10-14-20)16-15-19-11-7-5-8-12-19/h5-16,18,21-23H,17H2,1-4H3/b16-15+ |
| InChIKey | YNRDWLRPZJMGQM-FOCLMDBBSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|