C28H35F2N7O5 — CID 146347562
[(E,2S)-7-(dimethylamino)-1-[[6-fluoro-1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146347562) has the molecular formula C28H35F2N7O5 and a molecular weight of 587.63 g/mol. Its IUPAC name is [(E,2S)-7-(dimethylamino)-1-[[6-fluoro-1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-7-(dimethylamino)-1-[[6-fluoro-1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146347562 |
| Molecular Formula | C28H35F2N7O5 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | [(E,2S)-7-(dimethylamino)-1-[[6-fluoro-1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CC(C)Cc1ncc(F)c2nc(Cn3c(F)ccc(NC(=O)[C@H](CC/C=C/C(=O)N(C)C)OC(=O)N(C)C)c3=O)[nH]c12 |
| InChI | InChI=1S/C28H35F2N7O5/c1-16(2)13-19-25-24(17(29)14-31-19)33-22(34-25)15-37-21(30)12-11-18(27(37)40)32-26(39)20(42-28(41)36(5)6)9-7-8-10-23(38)35(3)4/h8,10-12,14,16,20H,7,9,13,15H2,1-6H3,(H,32,39)(H,33,34)/b10-8+/t20-/m0/s1 |
| InChIKey | YZQOXKRDUQUJOK-MFUYTVRRSA-N |
| XLogP | 3.07 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|