C30H39FN6O5 — CID 146347616
[(E,2S)-7-(dimethylamino)-1-[[1-[[7-(2,2-dimethylpropyl)-5-fluoro-1H-indol-2-yl]methyl]-6-oxopyrimidin-5-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146347616) has the molecular formula C30H39FN6O5 and a molecular weight of 582.68 g/mol. Its IUPAC name is [(E,2S)-7-(dimethylamino)-1-[[1-[[7-(2,2-dimethylpropyl)-5-fluoro-1H-indol-2-yl]methyl]-6-oxopyrimidin-5-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[7-(2,2-dimethylpropyl)-5-fluoro-1H-indol-2-yl]methyl]-6-oxopyrimidin-5-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146347616 |
| Molecular Formula | C30H39FN6O5 |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[7-(2,2-dimethylpropyl)-5-fluoro-1H-indol-2-yl]methyl]-6-oxopyrimidin-5-yl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](OC(=O)N(C)C)C(=O)Nc1cncn(Cc2cc3cc(F)cc(CC(C)(C)C)c3[nH]2)c1=O |
| InChI | InChI=1S/C30H39FN6O5/c1-30(2,3)15-20-13-21(31)12-19-14-22(33-26(19)20)17-37-18-32-16-23(28(37)40)34-27(39)24(42-29(41)36(6)7)10-8-9-11-25(38)35(4)5/h9,11-14,16,18,24,33H,8,10,15,17H2,1-7H3,(H,34,39)/b11-9+/t24-/m0/s1 |
| InChIKey | RSCDTYYEQJZVNH-LJTKGQTQSA-N |
| XLogP | 3.93 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|