C30H40FN7O5 — CID 146347730
[(E,2S)-7-(dimethylamino)-1-[[1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-5,6-dimethyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146347730) has the molecular formula C30H40FN7O5 and a molecular weight of 597.69 g/mol. Its IUPAC name is [(E,2S)-7-(dimethylamino)-1-[[1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-5,6-dimethyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-5,6-dimethyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146347730 |
| Molecular Formula | C30H40FN7O5 |
| Molecular Weight | 597.69 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-5,6-dimethyl-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | Cc1cc(NC(=O)[C@H](CC/C=C/C(=O)N(C)C)OC(=O)N(C)C)c(=O)n(Cc2nc3c(F)cnc(CC(C)C)c3[nH]2)c1C |
| InChI | InChI=1S/C30H40FN7O5/c1-17(2)13-21-27-26(20(31)15-32-21)34-24(35-27)16-38-19(4)18(3)14-22(29(38)41)33-28(40)23(43-30(42)37(7)8)11-9-10-12-25(39)36(5)6/h10,12,14-15,17,23H,9,11,13,16H2,1-8H3,(H,33,40)(H,34,35)/b12-10+/t23-/m0/s1 |
| InChIKey | UOGYESLOUKCTDC-XDQZKXAQSA-N |
| XLogP | 3.55 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.69 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|