C28H36FN7O5 — CID 146347785
[(E,2S)-7-(dimethylamino)-1-[[1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146347785) has the molecular formula C28H36FN7O5 and a molecular weight of 569.64 g/mol. Its IUPAC name is [(E,2S)-7-(dimethylamino)-1-[[1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146347785 |
| Molecular Formula | C28H36FN7O5 |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[7-fluoro-4-(2-methylpropyl)-3H-imidazo[4,5-c]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CC(C)Cc1ncc(F)c2nc(Cn3cccc(NC(=O)[C@H](CC/C=C/C(=O)N(C)C)OC(=O)N(C)C)c3=O)[nH]c12 |
| InChI | InChI=1S/C28H36FN7O5/c1-17(2)14-20-25-24(18(29)15-30-20)32-22(33-25)16-36-13-9-10-19(27(36)39)31-26(38)21(41-28(40)35(5)6)11-7-8-12-23(37)34(3)4/h8-10,12-13,15,17,21H,7,11,14,16H2,1-6H3,(H,31,38)(H,32,33)/b12-8+/t21-/m0/s1 |
| InChIKey | NWSCKTAAVYUKHE-HSRJRILOSA-N |
| XLogP | 2.94 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|