C27H32F3N7O5 — CID 146347876
[(E,2S)-7-(dimethylamino)-1,7-dioxo-1-[[2-oxo-1-[[4-(3,3,3-trifluoropropyl)-5H-pyrrolo[3,2-d]pyrimidin-6-yl]methyl]-3-pyridinyl]amino]hept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146347876) has the molecular formula C27H32F3N7O5 and a molecular weight of 591.59 g/mol. Its IUPAC name is [(E,2S)-7-(dimethylamino)-1,7-dioxo-1-[[2-oxo-1-[[4-(3,3,3-trifluoropropyl)-5H-pyrrolo[3,2-d]pyrimidin-6-yl]methyl]-3-pyridinyl]amino]hept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-7-(dimethylamino)-1,7-dioxo-1-[[2-oxo-1-[[4-(3,3,3-trifluoropropyl)-5H-pyrrolo[3,2-d]pyrimidin-6-yl]methyl]-3-pyridinyl]amino]hept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146347876 |
| Molecular Formula | C27H32F3N7O5 |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | [(E,2S)-7-(dimethylamino)-1,7-dioxo-1-[[2-oxo-1-[[4-(3,3,3-trifluoropropyl)-5H-pyrrolo[3,2-d]pyrimidin-6-yl]methyl]-3-pyridinyl]amino]hept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](OC(=O)N(C)C)C(=O)Nc1cccn(Cc2cc3ncnc(CCC(F)(F)F)c3[nH]2)c1=O |
| InChI | InChI=1S/C27H32F3N7O5/c1-35(2)22(38)10-6-5-9-21(42-26(41)36(3)4)24(39)34-19-8-7-13-37(25(19)40)15-17-14-20-23(33-17)18(31-16-32-20)11-12-27(28,29)30/h6-8,10,13-14,16,21,33H,5,9,11-12,15H2,1-4H3,(H,34,39)/b10-6+/t21-/m0/s1 |
| InChIKey | VNHGERKWVFOMCB-ISPXXFMDSA-N |
| XLogP | 3.09 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|