C28H32F4N6O5 — CID 146347884
[(E,2S)-7-(dimethylamino)-1-[[1-[[6-fluoro-4-(3,3,3-trifluoropropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146347884) has the molecular formula C28H32F4N6O5 and a molecular weight of 608.59 g/mol. Its IUPAC name is [(E,2S)-7-(dimethylamino)-1-[[1-[[6-fluoro-4-(3,3,3-trifluoropropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[6-fluoro-4-(3,3,3-trifluoropropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146347884 |
| Molecular Formula | C28H32F4N6O5 |
| Molecular Weight | 608.59 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[6-fluoro-4-(3,3,3-trifluoropropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](OC(=O)N(C)C)C(=O)Nc1cccn(Cc2nc3c(CCC(F)(F)F)cc(F)cc3[nH]2)c1=O |
| InChI | InChI=1S/C28H32F4N6O5/c1-36(2)23(39)10-6-5-9-21(43-27(42)37(3)4)25(40)34-19-8-7-13-38(26(19)41)16-22-33-20-15-18(29)14-17(24(20)35-22)11-12-28(30,31)32/h6-8,10,13-15,21H,5,9,11-12,16H2,1-4H3,(H,33,35)(H,34,40)/b10-6+/t21-/m0/s1 |
| InChIKey | IOYGFEPIODSDEQ-ISPXXFMDSA-N |
| XLogP | 3.84 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|