C30H38F2N6O5 — CID 146348107
[(E,2S)-7-(dimethylamino)-1-[[1-[[4-(2,2-dimethylpropyl)-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146348107) has the molecular formula C30H38F2N6O5 and a molecular weight of 600.67 g/mol. Its IUPAC name is [(E,2S)-7-(dimethylamino)-1-[[1-[[4-(2,2-dimethylpropyl)-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[4-(2,2-dimethylpropyl)-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146348107 |
| Molecular Formula | C30H38F2N6O5 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | [(E,2S)-7-(dimethylamino)-1-[[1-[[4-(2,2-dimethylpropyl)-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](OC(=O)N(C)C)C(=O)Nc1cccn(Cc2nc3c(CC(C)(C)C)c(F)c(F)cc3[nH]2)c1=O |
| InChI | InChI=1S/C30H38F2N6O5/c1-30(2,3)16-18-25(32)19(31)15-21-26(18)35-23(33-21)17-38-14-10-11-20(28(38)41)34-27(40)22(43-29(42)37(6)7)12-8-9-13-24(39)36(4)5/h9-11,13-15,22H,8,12,16-17H2,1-7H3,(H,33,35)(H,34,40)/b13-9+/t22-/m0/s1 |
| InChIKey | HQGNYPDUNRXRLL-XAYKGCCJSA-N |
| XLogP | 4.07 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|