C27H30F4N6O5 — CID 146348123
[(E,2S)-1-[[1-[[6-fluoro-4-(3,3,3-trifluoropropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(methylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146348123) has the molecular formula C27H30F4N6O5 and a molecular weight of 594.57 g/mol. Its IUPAC name is [(E,2S)-1-[[1-[[6-fluoro-4-(3,3,3-trifluoropropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(methylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-1-[[1-[[6-fluoro-4-(3,3,3-trifluoropropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(methylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146348123 |
| Molecular Formula | C27H30F4N6O5 |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | [(E,2S)-1-[[1-[[6-fluoro-4-(3,3,3-trifluoropropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(methylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CNC(=O)/C=C/CC[C@H](OC(=O)N(C)C)C(=O)Nc1cccn(Cc2nc3c(CCC(F)(F)F)cc(F)cc3[nH]2)c1=O |
| InChI | InChI=1S/C27H30F4N6O5/c1-32-22(38)9-5-4-8-20(42-26(41)36(2)3)24(39)34-18-7-6-12-37(25(18)40)15-21-33-19-14-17(28)13-16(23(19)35-21)10-11-27(29,30)31/h5-7,9,12-14,20H,4,8,10-11,15H2,1-3H3,(H,32,38)(H,33,35)(H,34,39)/b9-5+/t20-/m0/s1 |
| InChIKey | HTXDMQUXQMXUQW-MRSBXDGLSA-N |
| XLogP | 3.49 |
| TPSA | 138.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|