C29H36F2N6O5 — CID 146348350
[(E,2S)-1-[[1-[[5,6-difluoro-4-(2-methylpropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146348350) has the molecular formula C29H36F2N6O5 and a molecular weight of 586.64 g/mol. Its IUPAC name is [(E,2S)-1-[[1-[[5,6-difluoro-4-(2-methylpropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-1-[[1-[[5,6-difluoro-4-(2-methylpropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146348350 |
| Molecular Formula | C29H36F2N6O5 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | [(E,2S)-1-[[1-[[5,6-difluoro-4-(2-methylpropyl)-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CC(C)Cc1c(F)c(F)cc2[nH]c(Cn3cccc(NC(=O)[C@H](CC/C=C/C(=O)N(C)C)OC(=O)N(C)C)c3=O)nc12 |
| InChI | InChI=1S/C29H36F2N6O5/c1-17(2)14-18-25(31)19(30)15-21-26(18)34-23(32-21)16-37-13-9-10-20(28(37)40)33-27(39)22(42-29(41)36(5)6)11-7-8-12-24(38)35(3)4/h8-10,12-13,15,17,22H,7,11,14,16H2,1-6H3,(H,32,34)(H,33,39)/b12-8+/t22-/m0/s1 |
| InChIKey | OPZVHCIXHUDXKI-UBQCRTFRSA-N |
| XLogP | 3.68 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|