C32H32F4N6O6 — CID 146348504
[(E,2S)-1-[[1-[[4-[(2,4-difluorophenyl)methoxy]-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146348504) has the molecular formula C32H32F4N6O6 and a molecular weight of 672.64 g/mol. Its IUPAC name is [(E,2S)-1-[[1-[[4-[(2,4-difluorophenyl)methoxy]-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-1-[[1-[[4-[(2,4-difluorophenyl)methoxy]-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146348504 |
| Molecular Formula | C32H32F4N6O6 |
| Molecular Weight | 672.64 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | [(E,2S)-1-[[1-[[4-[(2,4-difluorophenyl)methoxy]-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](OC(=O)N(C)C)C(=O)Nc1cccn(Cc2nc3c(OCc4ccc(F)cc4F)c(F)c(F)cc3[nH]2)c1=O |
| InChI | InChI=1S/C32H32F4N6O6/c1-40(2)26(43)10-6-5-9-24(48-32(46)41(3)4)30(44)38-22-8-7-13-42(31(22)45)16-25-37-23-15-21(35)27(36)29(28(23)39-25)47-17-18-11-12-19(33)14-20(18)34/h6-8,10-15,24H,5,9,16-17H2,1-4H3,(H,37,39)(H,38,44)/b10-6+/t24-/m0/s1 |
| InChIKey | WYGRMJCIIBLQNU-VXFXUCHBSA-N |
| XLogP | 4.34 |
| TPSA | 138.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|