C29H36F2N6O5 — CID 146348512
methyl N-[(E,2S)-7-(dimethylamino)-1-[[1-[[4-(2,2-dimethylpropyl)-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate (PubChem CID 146348512) has the molecular formula C29H36F2N6O5 and a molecular weight of 586.64 g/mol. Its IUPAC name is methyl N-[(E,2S)-7-(dimethylamino)-1-[[1-[[4-(2,2-dimethylpropyl)-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate.
| Compound Name | methyl N-[(E,2S)-7-(dimethylamino)-1-[[1-[[4-(2,2-dimethylpropyl)-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 146348512 |
| Molecular Formula | C29H36F2N6O5 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | methyl N-[(E,2S)-7-(dimethylamino)-1-[[1-[[4-(2,2-dimethylpropyl)-5,6-difluoro-1H-benzimidazol-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](CC/C=C/C(=O)N(C)C)C(=O)Nc1cccn(Cc2nc3c(CC(C)(C)C)c(F)c(F)cc3[nH]2)c1=O |
| InChI | InChI=1S/C29H36F2N6O5/c1-29(2,3)15-17-24(31)18(30)14-21-25(17)35-22(32-21)16-37-13-9-11-20(27(37)40)33-26(39)19(34-28(41)42-6)10-7-8-12-23(38)36(4)5/h8-9,11-14,19H,7,10,15-16H2,1-6H3,(H,32,35)(H,33,39)(H,34,41)/b12-8+/t19-/m0/s1 |
| InChIKey | HRKVOVKCPJTMNX-BEBFYNPSSA-N |
| XLogP | 3.73 |
| TPSA | 138.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|